C19H30FN3O — CID 78892593
1-[(3-fluorophenyl)methyl]-1-methyl-3-[4-(4-methylpiperidin-1-yl)butyl]urea (PubChem CID 78892593) has the molecular formula C19H30FN3O and a molecular weight of 335.47 g/mol. Its IUPAC name is 1-[(3-fluorophenyl)methyl]-1-methyl-3-[4-(4-methylpiperidin-1-yl)butyl]urea.
| Compound Name | 1-[(3-fluorophenyl)methyl]-1-methyl-3-[4-(4-methylpiperidin-1-yl)butyl]urea |
|---|---|
| PubChem CID | 78892593 |
| Molecular Formula | C19H30FN3O |
| Molecular Weight | 335.47 g/mol |
| Exact Mass | 335.24 |
| IUPAC Name | 1-[(3-fluorophenyl)methyl]-1-methyl-3-[4-(4-methylpiperidin-1-yl)butyl]urea |
| SMILES | CC1CCN(CCCCNC(=O)N(C)Cc2cccc(F)c2)CC1 |
| InChI | InChI=1S/C19H30FN3O/c1-16-8-12-23(13-9-16)11-4-3-10-21-19(24)22(2)15-17-6-5-7-18(20)14-17/h5-7,14,16H,3-4,8-13,15H2,1-2H3,(H,21,24) |
| InChIKey | LGKLCVNEICFCMV-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.47 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|