C21H23NO3 — CID 78895130
[3-(2-oxopyrrolidin-1-yl)phenyl] 4-(4-methylphenyl)butanoate (PubChem CID 78895130) has the molecular formula C21H23NO3 and a molecular weight of 337.42 g/mol. Its IUPAC name is [3-(2-oxopyrrolidin-1-yl)phenyl] 4-(4-methylphenyl)butanoate.
| Compound Name | [3-(2-oxopyrrolidin-1-yl)phenyl] 4-(4-methylphenyl)butanoate |
|---|---|
| PubChem CID | 78895130 |
| Molecular Formula | C21H23NO3 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.17 |
| IUPAC Name | [3-(2-oxopyrrolidin-1-yl)phenyl] 4-(4-methylphenyl)butanoate |
| SMILES | Cc1ccc(CCCC(=O)Oc2cccc(N3CCCC3=O)c2)cc1 |
| InChI | InChI=1S/C21H23NO3/c1-16-10-12-17(13-11-16)5-2-9-21(24)25-19-7-3-6-18(15-19)22-14-4-8-20(22)23/h3,6-7,10-13,15H,2,4-5,8-9,14H2,1H3 |
| InChIKey | DWRNKIQOAQYZAE-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|