C21H23NO4 — CID 78895132
[3-(2-oxopyrrolidin-1-yl)phenyl] 3-(2,6-dimethylphenoxy)propanoate (PubChem CID 78895132) has the molecular formula C21H23NO4 and a molecular weight of 353.42 g/mol. Its IUPAC name is [3-(2-oxopyrrolidin-1-yl)phenyl] 3-(2,6-dimethylphenoxy)propanoate.
| Compound Name | [3-(2-oxopyrrolidin-1-yl)phenyl] 3-(2,6-dimethylphenoxy)propanoate |
|---|---|
| PubChem CID | 78895132 |
| Molecular Formula | C21H23NO4 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | [3-(2-oxopyrrolidin-1-yl)phenyl] 3-(2,6-dimethylphenoxy)propanoate |
| SMILES | Cc1cccc(C)c1OCCC(=O)Oc1cccc(N2CCCC2=O)c1 |
| InChI | InChI=1S/C21H23NO4/c1-15-6-3-7-16(2)21(15)25-13-11-20(24)26-18-9-4-8-17(14-18)22-12-5-10-19(22)23/h3-4,6-9,14H,5,10-13H2,1-2H3 |
| InChIKey | KGRNRXRMTHLLIL-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|