C23H22O3 — CID 7889553
[(2R)-1-(4-ethylphenyl)-1-oxopropan-2-yl] 2-naphthalen-1-ylacetate (PubChem CID 7889553) has the molecular formula C23H22O3 and a molecular weight of 346.43 g/mol. Its IUPAC name is [(2R)-1-(4-ethylphenyl)-1-oxopropan-2-yl] 2-naphthalen-1-ylacetate.
| Compound Name | [(2R)-1-(4-ethylphenyl)-1-oxopropan-2-yl] 2-naphthalen-1-ylacetate |
|---|---|
| PubChem CID | 7889553 |
| Molecular Formula | C23H22O3 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | [(2R)-1-(4-ethylphenyl)-1-oxopropan-2-yl] 2-naphthalen-1-ylacetate |
| SMILES | CCc1ccc(C(=O)[C@@H](C)OC(=O)Cc2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C23H22O3/c1-3-17-11-13-19(14-12-17)23(25)16(2)26-22(24)15-20-9-6-8-18-7-4-5-10-21(18)20/h4-14,16H,3,15H2,1-2H3/t16-/m1/s1 |
| InChIKey | DHOVWFQQPWTFAB-MRXNPFEDSA-N |
| XLogP | 4.76 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |