C23H23NO3S — CID 7175247
[(2S)-1-(4-ethylphenyl)-1-oxopropan-2-yl] 2-(4-methylquinolin-2-yl)sulfanylacetate (PubChem CID 7175247) has the molecular formula C23H23NO3S and a molecular weight of 393.51 g/mol. Its IUPAC name is [(2S)-1-(4-ethylphenyl)-1-oxopropan-2-yl] 2-(4-methylquinolin-2-yl)sulfanylacetate.
| Compound Name | [(2S)-1-(4-ethylphenyl)-1-oxopropan-2-yl] 2-(4-methylquinolin-2-yl)sulfanylacetate |
|---|---|
| PubChem CID | 7175247 |
| Molecular Formula | C23H23NO3S |
| Molecular Weight | 393.51 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | [(2S)-1-(4-ethylphenyl)-1-oxopropan-2-yl] 2-(4-methylquinolin-2-yl)sulfanylacetate |
| SMILES | CCc1ccc(C(=O)[C@H](C)OC(=O)CSc2cc(C)c3ccccc3n2)cc1 |
| InChI | InChI=1S/C23H23NO3S/c1-4-17-9-11-18(12-10-17)23(26)16(3)27-22(25)14-28-21-13-15(2)19-7-5-6-8-20(19)24-21/h5-13,16H,4,14H2,1-3H3/t16-/m0/s1 |
| InChIKey | IIHYJPACWGQXEU-INIZCTEOSA-N |
| XLogP | 5.01 |
| TPSA | 56.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.51 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |