C22H24N2OS — CID 4683672
2-(4-methylquinolin-2-yl)sulfanyl-N-(4-phenylbutan-2-yl)acetamide (PubChem CID 4683672) has the molecular formula C22H24N2OS and a molecular weight of 364.51 g/mol. Its IUPAC name is 2-(4-methylquinolin-2-yl)sulfanyl-N-(4-phenylbutan-2-yl)acetamide.
| Compound Name | 2-(4-methylquinolin-2-yl)sulfanyl-N-(4-phenylbutan-2-yl)acetamide |
|---|---|
| PubChem CID | 4683672 |
| Molecular Formula | C22H24N2OS |
| Molecular Weight | 364.51 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | 2-(4-methylquinolin-2-yl)sulfanyl-N-(4-phenylbutan-2-yl)acetamide |
| SMILES | Cc1cc(SCC(=O)NC(C)CCc2ccccc2)nc2ccccc12 |
| InChI | InChI=1S/C22H24N2OS/c1-16-14-22(24-20-11-7-6-10-19(16)20)26-15-21(25)23-17(2)12-13-18-8-4-3-5-9-18/h3-11,14,17H,12-13,15H2,1-2H3,(H,23,25) |
| InChIKey | VXQPNEUSVCBWTD-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.51 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |