C23H22N4OS — CID 41082611
N-[(1R)-1-(4-imidazol-1-ylphenyl)ethyl]-2-(4-methylquinolin-2-yl)sulfanylacetamide (PubChem CID 41082611) has the molecular formula C23H22N4OS and a molecular weight of 402.52 g/mol. Its IUPAC name is N-[(1R)-1-(4-imidazol-1-ylphenyl)ethyl]-2-(4-methylquinolin-2-yl)sulfanylacetamide.
| Compound Name | N-[(1R)-1-(4-imidazol-1-ylphenyl)ethyl]-2-(4-methylquinolin-2-yl)sulfanylacetamide |
|---|---|
| PubChem CID | 41082611 |
| Molecular Formula | C23H22N4OS |
| Molecular Weight | 402.52 g/mol |
| Exact Mass | 402.15 |
| IUPAC Name | N-[(1R)-1-(4-imidazol-1-ylphenyl)ethyl]-2-(4-methylquinolin-2-yl)sulfanylacetamide |
| SMILES | Cc1cc(SCC(=O)N[C@H](C)c2ccc(-n3ccnc3)cc2)nc2ccccc12 |
| InChI | InChI=1S/C23H22N4OS/c1-16-13-23(26-21-6-4-3-5-20(16)21)29-14-22(28)25-17(2)18-7-9-19(10-8-18)27-12-11-24-15-27/h3-13,15,17H,14H2,1-2H3,(H,25,28)/t17-/m1/s1 |
| InChIKey | DSKFTJNXHVXEPB-QGZVFWFLSA-N |
| XLogP | 4.70 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.52 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |