C21H17FN4O3 — CID 78895990
methyl 2-[(2-cyano-4-fluorophenyl)carbamoyl]-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylate (PubChem CID 78895990) has the molecular formula C21H17FN4O3 and a molecular weight of 392.39 g/mol. Its IUPAC name is methyl 2-[(2-cyano-4-fluorophenyl)carbamoyl]-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylate.
| Compound Name | methyl 2-[(2-cyano-4-fluorophenyl)carbamoyl]-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylate |
|---|---|
| PubChem CID | 78895990 |
| Molecular Formula | C21H17FN4O3 |
| Molecular Weight | 392.39 g/mol |
| Exact Mass | 392.13 |
| IUPAC Name | methyl 2-[(2-cyano-4-fluorophenyl)carbamoyl]-1,3,4,5-tetrahydropyrido[4,3-b]indole-8-carboxylate |
| SMILES | COC(=O)c1ccc2[nH]c3c(c2c1)CN(C(=O)Nc1ccc(F)cc1C#N)CC3 |
| InChI | InChI=1S/C21H17FN4O3/c1-29-20(27)12-2-4-18-15(9-12)16-11-26(7-6-19(16)24-18)21(28)25-17-5-3-14(22)8-13(17)10-23/h2-5,8-9,24H,6-7,11H2,1H3,(H,25,28) |
| InChIKey | WCJRPRAEEIJSKW-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 98.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.39 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|