C17H23FN2O2S — CID 78898738
1-[4-(2-fluorobenzoyl)-1,4-diazepan-1-yl]-2-propylsulfanylethanone (PubChem CID 78898738) has the molecular formula C17H23FN2O2S and a molecular weight of 338.45 g/mol. Its IUPAC name is 1-[4-(2-fluorobenzoyl)-1,4-diazepan-1-yl]-2-propylsulfanylethanone.
| Compound Name | 1-[4-(2-fluorobenzoyl)-1,4-diazepan-1-yl]-2-propylsulfanylethanone |
|---|---|
| PubChem CID | 78898738 |
| Molecular Formula | C17H23FN2O2S |
| Molecular Weight | 338.45 g/mol |
| Exact Mass | 338.15 |
| IUPAC Name | 1-[4-(2-fluorobenzoyl)-1,4-diazepan-1-yl]-2-propylsulfanylethanone |
| SMILES | CCCSCC(=O)N1CCCN(C(=O)c2ccccc2F)CC1 |
| InChI | InChI=1S/C17H23FN2O2S/c1-2-12-23-13-16(21)19-8-5-9-20(11-10-19)17(22)14-6-3-4-7-15(14)18/h3-4,6-7H,2,5,8-13H2,1H3 |
| InChIKey | MNKIMJGHVHMPRQ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.45 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|