C18H19BrN4O3 — CID 78899342
1-[4-[1-(4-bromo-2-nitroanilino)ethyl]phenyl]-3-cyclopropylurea (PubChem CID 78899342) has the molecular formula C18H19BrN4O3 and a molecular weight of 419.28 g/mol. Its IUPAC name is 1-[4-[1-(4-bromo-2-nitroanilino)ethyl]phenyl]-3-cyclopropylurea.
| Compound Name | 1-[4-[1-(4-bromo-2-nitroanilino)ethyl]phenyl]-3-cyclopropylurea |
|---|---|
| PubChem CID | 78899342 |
| Molecular Formula | C18H19BrN4O3 |
| Molecular Weight | 419.28 g/mol |
| Exact Mass | 418.06 |
| IUPAC Name | 1-[4-[1-(4-bromo-2-nitroanilino)ethyl]phenyl]-3-cyclopropylurea |
| SMILES | CC(Nc1ccc(Br)cc1[N+](=O)[O-])c1ccc(NC(=O)NC2CC2)cc1 |
| InChI | InChI=1S/C18H19BrN4O3/c1-11(20-16-9-4-13(19)10-17(16)23(25)26)12-2-5-14(6-3-12)21-18(24)22-15-7-8-15/h2-6,9-11,15,20H,7-8H2,1H3,(H2,21,22,24) |
| InChIKey | YRNSWICOUGUUFD-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.28 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|