C19H26N2O2 — CID 78899393
N-(furan-2-ylmethyl)-2-[methyl(3-methylbutyl)amino]-N-phenylacetamide (PubChem CID 78899393) has the molecular formula C19H26N2O2 and a molecular weight of 314.43 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-2-[methyl(3-methylbutyl)amino]-N-phenylacetamide.
| Compound Name | N-(furan-2-ylmethyl)-2-[methyl(3-methylbutyl)amino]-N-phenylacetamide |
|---|---|
| PubChem CID | 78899393 |
| Molecular Formula | C19H26N2O2 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | N-(furan-2-ylmethyl)-2-[methyl(3-methylbutyl)amino]-N-phenylacetamide |
| SMILES | CC(C)CCN(C)CC(=O)N(Cc1ccco1)c1ccccc1 |
| InChI | InChI=1S/C19H26N2O2/c1-16(2)11-12-20(3)15-19(22)21(14-18-10-7-13-23-18)17-8-5-4-6-9-17/h4-10,13,16H,11-12,14-15H2,1-3H3 |
| InChIKey | VFYOUHGDDYYLRC-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 36.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |