C20H21FN4O2S — CID 78901348
5-fluoro-N-[1-(4-methylphenyl)sulfonylpiperidin-4-yl]quinazolin-4-amine (PubChem CID 78901348) has the molecular formula C20H21FN4O2S and a molecular weight of 400.48 g/mol. Its IUPAC name is 5-fluoro-N-[1-(4-methylphenyl)sulfonylpiperidin-4-yl]quinazolin-4-amine.
| Compound Name | 5-fluoro-N-[1-(4-methylphenyl)sulfonylpiperidin-4-yl]quinazolin-4-amine |
|---|---|
| PubChem CID | 78901348 |
| Molecular Formula | C20H21FN4O2S |
| Molecular Weight | 400.48 g/mol |
| Exact Mass | 400.14 |
| IUPAC Name | 5-fluoro-N-[1-(4-methylphenyl)sulfonylpiperidin-4-yl]quinazolin-4-amine |
| SMILES | Cc1ccc(S(=O)(=O)N2CCC(Nc3ncnc4cccc(F)c34)CC2)cc1 |
| InChI | InChI=1S/C20H21FN4O2S/c1-14-5-7-16(8-6-14)28(26,27)25-11-9-15(10-12-25)24-20-19-17(21)3-2-4-18(19)22-13-23-20/h2-8,13,15H,9-12H2,1H3,(H,22,23,24) |
| InChIKey | WAUJUSSDGXSVRZ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.48 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |