C15H17N3O4 — CID 78901933
ethyl 2-[ethyl-(4-oxo-3H-phthalazine-1-carbonyl)amino]acetate (PubChem CID 78901933) has the molecular formula C15H17N3O4 and a molecular weight of 303.32 g/mol. Its IUPAC name is ethyl 2-[ethyl-(4-oxo-3H-phthalazine-1-carbonyl)amino]acetate.
| Compound Name | ethyl 2-[ethyl-(4-oxo-3H-phthalazine-1-carbonyl)amino]acetate |
|---|---|
| PubChem CID | 78901933 |
| Molecular Formula | C15H17N3O4 |
| Molecular Weight | 303.32 g/mol |
| Exact Mass | 303.12 |
| IUPAC Name | ethyl 2-[ethyl-(4-oxo-3H-phthalazine-1-carbonyl)amino]acetate |
| SMILES | CCOC(=O)CN(CC)C(=O)c1n[nH]c(=O)c2ccccc12 |
| InChI | InChI=1S/C15H17N3O4/c1-3-18(9-12(19)22-4-2)15(21)13-10-7-5-6-8-11(10)14(20)17-16-13/h5-8H,3-4,9H2,1-2H3,(H,17,20) |
| InChIKey | RIEHPGKNUZNSMR-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 92.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.32 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |