C15H18N4O3 — CID 32567639
N-ethyl-N-[2-(ethylamino)-2-oxoethyl]-4-oxo-3H-phthalazine-1-carboxamide (PubChem CID 32567639) has the molecular formula C15H18N4O3 and a molecular weight of 302.33 g/mol. Its IUPAC name is N-ethyl-N-[2-(ethylamino)-2-oxoethyl]-4-oxo-3H-phthalazine-1-carboxamide.
| Compound Name | N-ethyl-N-[2-(ethylamino)-2-oxoethyl]-4-oxo-3H-phthalazine-1-carboxamide |
|---|---|
| PubChem CID | 32567639 |
| Molecular Formula | C15H18N4O3 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | N-ethyl-N-[2-(ethylamino)-2-oxoethyl]-4-oxo-3H-phthalazine-1-carboxamide |
| SMILES | CCNC(=O)CN(CC)C(=O)c1n[nH]c(=O)c2ccccc12 |
| InChI | InChI=1S/C15H18N4O3/c1-3-16-12(20)9-19(4-2)15(22)13-10-7-5-6-8-11(10)14(21)18-17-13/h5-8H,3-4,9H2,1-2H3,(H,16,20)(H,18,21) |
| InChIKey | PNIXRPQZXRNZQT-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 95.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |