C11H12BrN3OS — CID 90482849
N-ethyl-4-oxo-3H-phthalazine-1-carbothioamide;hydrobromide (PubChem CID 90482849) has the molecular formula C11H12BrN3OS and a molecular weight of 314.21 g/mol. Its IUPAC name is N-ethyl-4-oxo-3H-phthalazine-1-carbothioamide;hydrobromide.
| Compound Name | N-ethyl-4-oxo-3H-phthalazine-1-carbothioamide;hydrobromide |
|---|---|
| PubChem CID | 90482849 |
| Molecular Formula | C11H12BrN3OS |
| Molecular Weight | 314.21 g/mol |
| Exact Mass | 312.99 |
| IUPAC Name | N-ethyl-4-oxo-3H-phthalazine-1-carbothioamide;hydrobromide |
| SMILES | Br.CCNC(=S)c1n[nH]c(=O)c2ccccc12 |
| InChI | InChI=1S/C11H11N3OS.BrH/c1-2-12-11(16)9-7-5-3-4-6-8(7)10(15)14-13-9;/h3-6H,2H2,1H3,(H,12,16)(H,14,15);1H |
| InChIKey | VTNLRQMFPZPJCZ-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.21 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|