C21H42N4O3S — CID 78903264
2-[4-(cyclohexylmethyl)-1,4-diazepan-1-yl]-N-[3-[methylsulfonyl(propan-2-yl)amino]propyl]acetamide (PubChem CID 78903264) has the molecular formula C21H42N4O3S and a molecular weight of 430.66 g/mol. Its IUPAC name is 2-[4-(cyclohexylmethyl)-1,4-diazepan-1-yl]-N-[3-[methylsulfonyl(propan-2-yl)amino]propyl]acetamide.
| Compound Name | 2-[4-(cyclohexylmethyl)-1,4-diazepan-1-yl]-N-[3-[methylsulfonyl(propan-2-yl)amino]propyl]acetamide |
|---|---|
| PubChem CID | 78903264 |
| Molecular Formula | C21H42N4O3S |
| Molecular Weight | 430.66 g/mol |
| Exact Mass | 430.30 |
| IUPAC Name | 2-[4-(cyclohexylmethyl)-1,4-diazepan-1-yl]-N-[3-[methylsulfonyl(propan-2-yl)amino]propyl]acetamide |
| SMILES | CC(C)N(CCCNC(=O)CN1CCCN(CC2CCCCC2)CC1)S(C)(=O)=O |
| InChI | InChI=1S/C21H42N4O3S/c1-19(2)25(29(3,27)28)14-7-11-22-21(26)18-24-13-8-12-23(15-16-24)17-20-9-5-4-6-10-20/h19-20H,4-18H2,1-3H3,(H,22,26) |
| InChIKey | PKFFTPNTOTYOPE-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 72.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.66 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|