C13H15NO3 — CID 78906680
N-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)but-2-enamide (PubChem CID 78906680) has the molecular formula C13H15NO3 and a molecular weight of 233.27 g/mol. Its IUPAC name is N-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)but-2-enamide.
| Compound Name | N-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)but-2-enamide |
|---|---|
| PubChem CID | 78906680 |
| Molecular Formula | C13H15NO3 |
| Molecular Weight | 233.27 g/mol |
| Exact Mass | 233.11 |
| IUPAC Name | N-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)but-2-enamide |
| SMILES | CC=CC(=O)Nc1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C13H15NO3/c1-2-4-13(15)14-10-5-6-11-12(9-10)17-8-3-7-16-11/h2,4-6,9H,3,7-8H2,1H3,(H,14,15) |
| InChIKey | BLEWDNNKINPLIB-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.27 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|