C19H18BrNO4 — CID 26712250
(E)-3-(5-bromo-2-methoxyphenyl)-N-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)prop-2-enamide (PubChem CID 26712250) has the molecular formula C19H18BrNO4 and a molecular weight of 404.26 g/mol. Its IUPAC name is (E)-3-(5-bromo-2-methoxyphenyl)-N-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)prop-2-enamide.
| Compound Name | (E)-3-(5-bromo-2-methoxyphenyl)-N-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)prop-2-enamide |
|---|---|
| PubChem CID | 26712250 |
| Molecular Formula | C19H18BrNO4 |
| Molecular Weight | 404.26 g/mol |
| Exact Mass | 403.04 |
| IUPAC Name | (E)-3-(5-bromo-2-methoxyphenyl)-N-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)prop-2-enamide |
| SMILES | COc1ccc(Br)cc1/C=C/C(=O)Nc1ccc2c(c1)OCCCO2 |
| InChI | InChI=1S/C19H18BrNO4/c1-23-16-6-4-14(20)11-13(16)3-8-19(22)21-15-5-7-17-18(12-15)25-10-2-9-24-17/h3-8,11-12H,2,9-10H2,1H3,(H,21,22)/b8-3+ |
| InChIKey | DASMCHGTXHWGBV-FPYGCLRLSA-N |
| XLogP | 4.27 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.26 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|