C11H12N4O — CID 78909463
N-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)but-2-enamide (PubChem CID 78909463) has the molecular formula C11H12N4O and a molecular weight of 216.24 g/mol. Its IUPAC name is N-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)but-2-enamide.
| Compound Name | N-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)but-2-enamide |
|---|---|
| PubChem CID | 78909463 |
| Molecular Formula | C11H12N4O |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | N-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)but-2-enamide |
| SMILES | CC=CC(=O)NCc1nnc2ccccn12 |
| InChI | InChI=1S/C11H12N4O/c1-2-5-11(16)12-8-10-14-13-9-6-3-4-7-15(9)10/h2-7H,8H2,1H3,(H,12,16) |
| InChIKey | BUIBZILVJZWMLV-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|