C18H17N3O6 — CID 7891032
[(2R)-1-(3-acetylanilino)-1-oxopropan-2-yl] 4-amino-3-nitrobenzoate (PubChem CID 7891032) has the molecular formula C18H17N3O6 and a molecular weight of 371.35 g/mol. Its IUPAC name is [(2R)-1-(3-acetylanilino)-1-oxopropan-2-yl] 4-amino-3-nitrobenzoate.
| Compound Name | [(2R)-1-(3-acetylanilino)-1-oxopropan-2-yl] 4-amino-3-nitrobenzoate |
|---|---|
| PubChem CID | 7891032 |
| Molecular Formula | C18H17N3O6 |
| Molecular Weight | 371.35 g/mol |
| Exact Mass | 371.11 |
| IUPAC Name | [(2R)-1-(3-acetylanilino)-1-oxopropan-2-yl] 4-amino-3-nitrobenzoate |
| SMILES | CC(=O)c1cccc(NC(=O)[C@@H](C)OC(=O)c2ccc(N)c([N+](=O)[O-])c2)c1 |
| InChI | InChI=1S/C18H17N3O6/c1-10(22)12-4-3-5-14(8-12)20-17(23)11(2)27-18(24)13-6-7-15(19)16(9-13)21(25)26/h3-9,11H,19H2,1-2H3,(H,20,23)/t11-/m1/s1 |
| InChIKey | RORARMQSRPJBMX-LLVKDONJSA-N |
| XLogP | 2.56 |
| TPSA | 141.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.35 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|