C12H12N4S — CID 78911712
N-[(1-methylbenzimidazol-2-yl)methyl]-1,3-thiazol-2-amine (PubChem CID 78911712) has the molecular formula C12H12N4S and a molecular weight of 244.32 g/mol. Its IUPAC name is N-[(1-methylbenzimidazol-2-yl)methyl]-1,3-thiazol-2-amine.
| Compound Name | N-[(1-methylbenzimidazol-2-yl)methyl]-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 78911712 |
| Molecular Formula | C12H12N4S |
| Molecular Weight | 244.32 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | N-[(1-methylbenzimidazol-2-yl)methyl]-1,3-thiazol-2-amine |
| SMILES | Cn1c(CNc2nccs2)nc2ccccc21 |
| InChI | InChI=1S/C12H12N4S/c1-16-10-5-3-2-4-9(10)15-11(16)8-14-12-13-6-7-17-12/h2-7H,8H2,1H3,(H,13,14) |
| InChIKey | RVOVPNGNUYXNRF-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.32 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |