About N-decyladamantan-2-amine
N-decyladamantan-2-amine (PubChem CID 78912562) has the molecular formula C20H37N
and a molecular weight of 291.52 g/mol. Its IUPAC name is N-decyladamantan-2-amine.
Molecular Properties
| Compound Name | N-decyladamantan-2-amine |
| PubChem CID | 78912562 |
| Molecular Formula | C20H37N |
| Molecular Weight | 291.52 g/mol |
| Exact Mass | 291.29 |
| IUPAC Name | N-decyladamantan-2-amine |
| SMILES | CCCCCCCCCCNC1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C20H37N/c1-2-3-4-5-6-7-8-9-10-21-20-18-12-16-11-17(14-18)15-19(20)13-16/h16-21H,2-15H2,1H3 |
| InChIKey | CDLSRBIRQROJDL-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 291.52 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-decyladamantan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-decyladamantan-2-amine?
The IUPAC name of N-decyladamantan-2-amine (CID 78912562) is N-decyladamantan-2-amine.
What is the SMILES notation for N-decyladamantan-2-amine?
The canonical SMILES for N-decyladamantan-2-amine is CCCCCCCCCCNC1C2CC3CC(C2)CC1C3.
What is the InChIKey of N-decyladamantan-2-amine?
The InChIKey is CDLSRBIRQROJDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H37N/c1-2-3-4-5-6-7-8-9-10-21-20-18-12-16-11-17(14-18)15-19(20)13-16/h16-21H,2-15H2,1H3.
What are the key properties of N-decyladamantan-2-amine?
N-decyladamantan-2-amine has a molecular weight of 291.52 g/mol, XLogP of 5.54, 10 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-decyladamantan-2-amine is sourced from PubChem (CID 78912562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).