C20H17ClN2O4 — CID 7891604
[2-(4-chloro-2-methoxy-5-methylanilino)-2-oxoethyl] quinoline-2-carboxylate (PubChem CID 7891604) has the molecular formula C20H17ClN2O4 and a molecular weight of 384.82 g/mol. Its IUPAC name is [2-(4-chloro-2-methoxy-5-methylanilino)-2-oxoethyl] quinoline-2-carboxylate.
| Compound Name | [2-(4-chloro-2-methoxy-5-methylanilino)-2-oxoethyl] quinoline-2-carboxylate |
|---|---|
| PubChem CID | 7891604 |
| Molecular Formula | C20H17ClN2O4 |
| Molecular Weight | 384.82 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | [2-(4-chloro-2-methoxy-5-methylanilino)-2-oxoethyl] quinoline-2-carboxylate |
| SMILES | COc1cc(Cl)c(C)cc1NC(=O)COC(=O)c1ccc2ccccc2n1 |
| InChI | InChI=1S/C20H17ClN2O4/c1-12-9-17(18(26-2)10-14(12)21)23-19(24)11-27-20(25)16-8-7-13-5-3-4-6-15(13)22-16/h3-10H,11H2,1-2H3,(H,23,24) |
| InChIKey | BOHXOARMCOBDFT-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.82 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |