C13H13F4N3 — CID 78921126
1-[4-fluoro-2-(trifluoromethyl)phenyl]-N-[(1-methylpyrazol-3-yl)methyl]methanamine (PubChem CID 78921126) has the molecular formula C13H13F4N3 and a molecular weight of 287.26 g/mol. Its IUPAC name is 1-[4-fluoro-2-(trifluoromethyl)phenyl]-N-[(1-methylpyrazol-3-yl)methyl]methanamine.
| Compound Name | 1-[4-fluoro-2-(trifluoromethyl)phenyl]-N-[(1-methylpyrazol-3-yl)methyl]methanamine |
|---|---|
| PubChem CID | 78921126 |
| Molecular Formula | C13H13F4N3 |
| Molecular Weight | 287.26 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 1-[4-fluoro-2-(trifluoromethyl)phenyl]-N-[(1-methylpyrazol-3-yl)methyl]methanamine |
| SMILES | Cn1ccc(CNCc2ccc(F)cc2C(F)(F)F)n1 |
| InChI | InChI=1S/C13H13F4N3/c1-20-5-4-11(19-20)8-18-7-9-2-3-10(14)6-12(9)13(15,16)17/h2-6,18H,7-8H2,1H3 |
| InChIKey | UDIIIYOJSVJYML-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.26 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |