C15H12F5N — CID 112731308
N-[(2-fluorophenyl)methyl]-1-[4-fluoro-2-(trifluoromethyl)phenyl]methanamine (PubChem CID 112731308) has the molecular formula C15H12F5N and a molecular weight of 301.26 g/mol. Its IUPAC name is N-[(2-fluorophenyl)methyl]-1-[4-fluoro-2-(trifluoromethyl)phenyl]methanamine.
| Compound Name | N-[(2-fluorophenyl)methyl]-1-[4-fluoro-2-(trifluoromethyl)phenyl]methanamine |
|---|---|
| PubChem CID | 112731308 |
| Molecular Formula | C15H12F5N |
| Molecular Weight | 301.26 g/mol |
| Exact Mass | 301.09 |
| IUPAC Name | N-[(2-fluorophenyl)methyl]-1-[4-fluoro-2-(trifluoromethyl)phenyl]methanamine |
| SMILES | Fc1ccc(CNCc2ccccc2F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H12F5N/c16-12-6-5-10(13(7-12)15(18,19)20)8-21-9-11-3-1-2-4-14(11)17/h1-7,21H,8-9H2 |
| InChIKey | LRFJUWXPRBKIKM-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.26 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |