C14H13F4NO — CID 78921861
1-[4-fluoro-2-(trifluoromethyl)phenyl]-N-[(5-methylfuran-2-yl)methyl]methanamine (PubChem CID 78921861) has the molecular formula C14H13F4NO and a molecular weight of 287.26 g/mol. Its IUPAC name is 1-[4-fluoro-2-(trifluoromethyl)phenyl]-N-[(5-methylfuran-2-yl)methyl]methanamine.
| Compound Name | 1-[4-fluoro-2-(trifluoromethyl)phenyl]-N-[(5-methylfuran-2-yl)methyl]methanamine |
|---|---|
| PubChem CID | 78921861 |
| Molecular Formula | C14H13F4NO |
| Molecular Weight | 287.26 g/mol |
| Exact Mass | 287.09 |
| IUPAC Name | 1-[4-fluoro-2-(trifluoromethyl)phenyl]-N-[(5-methylfuran-2-yl)methyl]methanamine |
| SMILES | Cc1ccc(CNCc2ccc(F)cc2C(F)(F)F)o1 |
| InChI | InChI=1S/C14H13F4NO/c1-9-2-5-12(20-9)8-19-7-10-3-4-11(15)6-13(10)14(16,17)18/h2-6,19H,7-8H2,1H3 |
| InChIKey | BJQDWKLIWCVAGY-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.26 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |