C13H11F4NS — CID 78921732
N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-1-thiophen-3-ylmethanamine (PubChem CID 78921732) has the molecular formula C13H11F4NS and a molecular weight of 289.30 g/mol. Its IUPAC name is N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-1-thiophen-3-ylmethanamine.
| Compound Name | N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-1-thiophen-3-ylmethanamine |
|---|---|
| PubChem CID | 78921732 |
| Molecular Formula | C13H11F4NS |
| Molecular Weight | 289.30 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | N-[[4-fluoro-2-(trifluoromethyl)phenyl]methyl]-1-thiophen-3-ylmethanamine |
| SMILES | Fc1ccc(CNCc2ccsc2)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H11F4NS/c14-11-2-1-10(12(5-11)13(15,16)17)7-18-6-9-3-4-19-8-9/h1-5,8,18H,6-7H2 |
| InChIKey | YIODQBYDMICHNY-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.30 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |