C13H20N2O2 — CID 78928626
2-[[(4-hydroxycyclohexyl)amino]methyl]-6-methylpyridin-3-ol (PubChem CID 78928626) has the molecular formula C13H20N2O2 and a molecular weight of 236.31 g/mol. Its IUPAC name is 2-[[(4-hydroxycyclohexyl)amino]methyl]-6-methylpyridin-3-ol.
| Compound Name | 2-[[(4-hydroxycyclohexyl)amino]methyl]-6-methylpyridin-3-ol |
|---|---|
| PubChem CID | 78928626 |
| Molecular Formula | C13H20N2O2 |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.15 |
| IUPAC Name | 2-[[(4-hydroxycyclohexyl)amino]methyl]-6-methylpyridin-3-ol |
| SMILES | Cc1ccc(O)c(CNC2CCC(O)CC2)n1 |
| InChI | InChI=1S/C13H20N2O2/c1-9-2-7-13(17)12(15-9)8-14-10-3-5-11(16)6-4-10/h2,7,10-11,14,16-17H,3-6,8H2,1H3 |
| InChIKey | AYISHZWPAWZONE-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |