C11H16N2O — CID 78950424
2-[(cyclobutylamino)methyl]-6-methylpyridin-3-ol (PubChem CID 78950424) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is 2-[(cyclobutylamino)methyl]-6-methylpyridin-3-ol.
| Compound Name | 2-[(cyclobutylamino)methyl]-6-methylpyridin-3-ol |
|---|---|
| PubChem CID | 78950424 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | 2-[(cyclobutylamino)methyl]-6-methylpyridin-3-ol |
| SMILES | Cc1ccc(O)c(CNC2CCC2)n1 |
| InChI | InChI=1S/C11H16N2O/c1-8-5-6-11(14)10(13-8)7-12-9-3-2-4-9/h5-6,9,12,14H,2-4,7H2,1H3 |
| InChIKey | UYIPZDCDFNWJMJ-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |