C10H16BrN3S — CID 78931918
2-[(3-bromothiophen-2-yl)methyl]-1-tert-butylguanidine (PubChem CID 78931918) has the molecular formula C10H16BrN3S and a molecular weight of 290.23 g/mol. Its IUPAC name is 2-[(3-bromothiophen-2-yl)methyl]-1-tert-butylguanidine.
| Compound Name | 2-[(3-bromothiophen-2-yl)methyl]-1-tert-butylguanidine |
|---|---|
| PubChem CID | 78931918 |
| Molecular Formula | C10H16BrN3S |
| Molecular Weight | 290.23 g/mol |
| Exact Mass | 289.02 |
| IUPAC Name | 2-[(3-bromothiophen-2-yl)methyl]-1-tert-butylguanidine |
| SMILES | CC(C)(C)N/C(N)=N/Cc1sccc1Br |
| InChI | InChI=1S/C10H16BrN3S/c1-10(2,3)14-9(12)13-6-8-7(11)4-5-15-8/h4-5H,6H2,1-3H3,(H3,12,13,14) |
| InChIKey | PLOZJKSBDOSIPL-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.23 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|