C14H23FN2O — CID 78934634
2-[2-[(1S)-1-aminoethyl]-N-butyl-3-fluoroanilino]ethanol (PubChem CID 78934634) has the molecular formula C14H23FN2O and a molecular weight of 254.35 g/mol. Its IUPAC name is 2-[2-[(1S)-1-aminoethyl]-N-butyl-3-fluoroanilino]ethanol.
| Compound Name | 2-[2-[(1S)-1-aminoethyl]-N-butyl-3-fluoroanilino]ethanol |
|---|---|
| PubChem CID | 78934634 |
| Molecular Formula | C14H23FN2O |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | 2-[2-[(1S)-1-aminoethyl]-N-butyl-3-fluoroanilino]ethanol |
| SMILES | CCCCN(CCO)c1cccc(F)c1[C@H](C)N |
| InChI | InChI=1S/C14H23FN2O/c1-3-4-8-17(9-10-18)13-7-5-6-12(15)14(13)11(2)16/h5-7,11,18H,3-4,8-10,16H2,1-2H3/t11-/m0/s1 |
| InChIKey | JCTIREIETVJPSM-NSHDSACASA-N |
| XLogP | 2.44 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |