C16H19ClN2 — CID 78934700
4-[(1S)-1-aminoethyl]-N-[(3-chlorophenyl)methyl]-N-methylaniline (PubChem CID 78934700) has the molecular formula C16H19ClN2 and a molecular weight of 274.80 g/mol. Its IUPAC name is 4-[(1S)-1-aminoethyl]-N-[(3-chlorophenyl)methyl]-N-methylaniline.
| Compound Name | 4-[(1S)-1-aminoethyl]-N-[(3-chlorophenyl)methyl]-N-methylaniline |
|---|---|
| PubChem CID | 78934700 |
| Molecular Formula | C16H19ClN2 |
| Molecular Weight | 274.80 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 4-[(1S)-1-aminoethyl]-N-[(3-chlorophenyl)methyl]-N-methylaniline |
| SMILES | C[C@H](N)c1ccc(N(C)Cc2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C16H19ClN2/c1-12(18)14-6-8-16(9-7-14)19(2)11-13-4-3-5-15(17)10-13/h3-10,12H,11,18H2,1-2H3/t12-/m0/s1 |
| InChIKey | FXSNDAXEBASFLZ-LBPRGKRZSA-N |
| XLogP | 4.00 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.80 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|