C16H18ClFN2 — CID 78934812
2-[(1S)-1-aminoethyl]-N-[(3-chlorophenyl)methyl]-3-fluoro-N-methylaniline (PubChem CID 78934812) has the molecular formula C16H18ClFN2 and a molecular weight of 292.79 g/mol. Its IUPAC name is 2-[(1S)-1-aminoethyl]-N-[(3-chlorophenyl)methyl]-3-fluoro-N-methylaniline.
| Compound Name | 2-[(1S)-1-aminoethyl]-N-[(3-chlorophenyl)methyl]-3-fluoro-N-methylaniline |
|---|---|
| PubChem CID | 78934812 |
| Molecular Formula | C16H18ClFN2 |
| Molecular Weight | 292.79 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 2-[(1S)-1-aminoethyl]-N-[(3-chlorophenyl)methyl]-3-fluoro-N-methylaniline |
| SMILES | C[C@H](N)c1c(F)cccc1N(C)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C16H18ClFN2/c1-11(19)16-14(18)7-4-8-15(16)20(2)10-12-5-3-6-13(17)9-12/h3-9,11H,10,19H2,1-2H3/t11-/m0/s1 |
| InChIKey | ZKQLMMLMHFMGKC-NSHDSACASA-N |
| XLogP | 4.14 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.79 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |