C13H19FN2O2 — CID 78940251
2-[N-ethyl-2-fluoro-4-[(1S)-1-hydroxyethyl]anilino]-N-methylacetamide (PubChem CID 78940251) has the molecular formula C13H19FN2O2 and a molecular weight of 254.31 g/mol. Its IUPAC name is 2-[N-ethyl-2-fluoro-4-[(1S)-1-hydroxyethyl]anilino]-N-methylacetamide.
| Compound Name | 2-[N-ethyl-2-fluoro-4-[(1S)-1-hydroxyethyl]anilino]-N-methylacetamide |
|---|---|
| PubChem CID | 78940251 |
| Molecular Formula | C13H19FN2O2 |
| Molecular Weight | 254.31 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | 2-[N-ethyl-2-fluoro-4-[(1S)-1-hydroxyethyl]anilino]-N-methylacetamide |
| SMILES | CCN(CC(=O)NC)c1ccc([C@H](C)O)cc1F |
| InChI | InChI=1S/C13H19FN2O2/c1-4-16(8-13(18)15-3)12-6-5-10(9(2)17)7-11(12)14/h5-7,9,17H,4,8H2,1-3H3,(H,15,18)/t9-/m0/s1 |
| InChIKey | NAKFCOGNFGXZIJ-VIFPVBQESA-N |
| XLogP | 1.45 |
| TPSA | 52.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.31 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|