C16H26FN3O — CID 63059377
2-[N-ethyl-4-fluoro-2-[(2-methylpropylamino)methyl]anilino]-N-methylacetamide (PubChem CID 63059377) has the molecular formula C16H26FN3O and a molecular weight of 295.40 g/mol. Its IUPAC name is 2-[N-ethyl-4-fluoro-2-[(2-methylpropylamino)methyl]anilino]-N-methylacetamide.
| Compound Name | 2-[N-ethyl-4-fluoro-2-[(2-methylpropylamino)methyl]anilino]-N-methylacetamide |
|---|---|
| PubChem CID | 63059377 |
| Molecular Formula | C16H26FN3O |
| Molecular Weight | 295.40 g/mol |
| Exact Mass | 295.21 |
| IUPAC Name | 2-[N-ethyl-4-fluoro-2-[(2-methylpropylamino)methyl]anilino]-N-methylacetamide |
| SMILES | CCN(CC(=O)NC)c1ccc(F)cc1CNCC(C)C |
| InChI | InChI=1S/C16H26FN3O/c1-5-20(11-16(21)18-4)15-7-6-14(17)8-13(15)10-19-9-12(2)3/h6-8,12,19H,5,9-11H2,1-4H3,(H,18,21) |
| InChIKey | BQYBGWXKCSEAMI-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 44.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.40 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |