C16H27FN2O — CID 63059193
N-ethyl-4-fluoro-N-(2-methoxyethyl)-2-[(2-methylpropylamino)methyl]aniline (PubChem CID 63059193) has the molecular formula C16H27FN2O and a molecular weight of 282.40 g/mol. Its IUPAC name is N-ethyl-4-fluoro-N-(2-methoxyethyl)-2-[(2-methylpropylamino)methyl]aniline.
| Compound Name | N-ethyl-4-fluoro-N-(2-methoxyethyl)-2-[(2-methylpropylamino)methyl]aniline |
|---|---|
| PubChem CID | 63059193 |
| Molecular Formula | C16H27FN2O |
| Molecular Weight | 282.40 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | N-ethyl-4-fluoro-N-(2-methoxyethyl)-2-[(2-methylpropylamino)methyl]aniline |
| SMILES | CCN(CCOC)c1ccc(F)cc1CNCC(C)C |
| InChI | InChI=1S/C16H27FN2O/c1-5-19(8-9-20-4)16-7-6-15(17)10-14(16)12-18-11-13(2)3/h6-7,10,13,18H,5,8-9,11-12H2,1-4H3 |
| InChIKey | VTXXDSHBITXKSB-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.40 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |