C16H20ClNOS — CID 78940291
(1S)-1-[3-chloro-4-[propan-2-yl(thiophen-2-ylmethyl)amino]phenyl]ethanol (PubChem CID 78940291) has the molecular formula C16H20ClNOS and a molecular weight of 309.86 g/mol. Its IUPAC name is (1S)-1-[3-chloro-4-[propan-2-yl(thiophen-2-ylmethyl)amino]phenyl]ethanol.
| Compound Name | (1S)-1-[3-chloro-4-[propan-2-yl(thiophen-2-ylmethyl)amino]phenyl]ethanol |
|---|---|
| PubChem CID | 78940291 |
| Molecular Formula | C16H20ClNOS |
| Molecular Weight | 309.86 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | (1S)-1-[3-chloro-4-[propan-2-yl(thiophen-2-ylmethyl)amino]phenyl]ethanol |
| SMILES | CC(C)N(Cc1cccs1)c1ccc([C@H](C)O)cc1Cl |
| InChI | InChI=1S/C16H20ClNOS/c1-11(2)18(10-14-5-4-8-20-14)16-7-6-13(12(3)19)9-15(16)17/h4-9,11-12,19H,10H2,1-3H3/t12-/m0/s1 |
| InChIKey | DWZVRYUWKJIRPI-LBPRGKRZSA-N |
| XLogP | 4.87 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.86 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|