C13H15N3O3 — CID 78941404
(1S)-1-[4-(4,5-dimethylimidazol-1-yl)-3-nitrophenyl]ethanol (PubChem CID 78941404) has the molecular formula C13H15N3O3 and a molecular weight of 261.28 g/mol. Its IUPAC name is (1S)-1-[4-(4,5-dimethylimidazol-1-yl)-3-nitrophenyl]ethanol.
| Compound Name | (1S)-1-[4-(4,5-dimethylimidazol-1-yl)-3-nitrophenyl]ethanol |
|---|---|
| PubChem CID | 78941404 |
| Molecular Formula | C13H15N3O3 |
| Molecular Weight | 261.28 g/mol |
| Exact Mass | 261.11 |
| IUPAC Name | (1S)-1-[4-(4,5-dimethylimidazol-1-yl)-3-nitrophenyl]ethanol |
| SMILES | Cc1ncn(-c2ccc([C@H](C)O)cc2[N+](=O)[O-])c1C |
| InChI | InChI=1S/C13H15N3O3/c1-8-9(2)15(7-14-8)12-5-4-11(10(3)17)6-13(12)16(18)19/h4-7,10,17H,1-3H3/t10-/m0/s1 |
| InChIKey | QHRAGMXNMBKUEZ-JTQLQIEISA-N |
| XLogP | 2.45 |
| TPSA | 81.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.28 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|