C13H19NO4S — CID 78945933
methyl 2-[(3-methoxythiophene-2-carbonyl)amino]-2-methylpentanoate (PubChem CID 78945933) has the molecular formula C13H19NO4S and a molecular weight of 285.36 g/mol. Its IUPAC name is methyl 2-[(3-methoxythiophene-2-carbonyl)amino]-2-methylpentanoate.
| Compound Name | methyl 2-[(3-methoxythiophene-2-carbonyl)amino]-2-methylpentanoate |
|---|---|
| PubChem CID | 78945933 |
| Molecular Formula | C13H19NO4S |
| Molecular Weight | 285.36 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | methyl 2-[(3-methoxythiophene-2-carbonyl)amino]-2-methylpentanoate |
| SMILES | CCCC(C)(NC(=O)c1sccc1OC)C(=O)OC |
| InChI | InChI=1S/C13H19NO4S/c1-5-7-13(2,12(16)18-4)14-11(15)10-9(17-3)6-8-19-10/h6,8H,5,7H2,1-4H3,(H,14,15) |
| InChIKey | QCNNYTRMULHVMO-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.36 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |