C11H15Br2NO2S — CID 107867966
N-[1-bromo-2-(bromomethyl)butan-2-yl]-3-methoxythiophene-2-carboxamide (PubChem CID 107867966) has the molecular formula C11H15Br2NO2S and a molecular weight of 385.12 g/mol. Its IUPAC name is N-[1-bromo-2-(bromomethyl)butan-2-yl]-3-methoxythiophene-2-carboxamide.
| Compound Name | N-[1-bromo-2-(bromomethyl)butan-2-yl]-3-methoxythiophene-2-carboxamide |
|---|---|
| PubChem CID | 107867966 |
| Molecular Formula | C11H15Br2NO2S |
| Molecular Weight | 385.12 g/mol |
| Exact Mass | 382.92 |
| IUPAC Name | N-[1-bromo-2-(bromomethyl)butan-2-yl]-3-methoxythiophene-2-carboxamide |
| SMILES | CCC(CBr)(CBr)NC(=O)c1sccc1OC |
| InChI | InChI=1S/C11H15Br2NO2S/c1-3-11(6-12,7-13)14-10(15)9-8(16-2)4-5-17-9/h4-5H,3,6-7H2,1-2H3,(H,14,15) |
| InChIKey | SFZGVDMKTVSTKG-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.12 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|