C14H19N3O4 — CID 78946014
4-[4-[(1S)-1-hydroxyethyl]-2-nitrophenyl]-3,3-dimethylpiperazin-2-one (PubChem CID 78946014) has the molecular formula C14H19N3O4 and a molecular weight of 293.32 g/mol. Its IUPAC name is 4-[4-[(1S)-1-hydroxyethyl]-2-nitrophenyl]-3,3-dimethylpiperazin-2-one.
| Compound Name | 4-[4-[(1S)-1-hydroxyethyl]-2-nitrophenyl]-3,3-dimethylpiperazin-2-one |
|---|---|
| PubChem CID | 78946014 |
| Molecular Formula | C14H19N3O4 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | 4-[4-[(1S)-1-hydroxyethyl]-2-nitrophenyl]-3,3-dimethylpiperazin-2-one |
| SMILES | C[C@H](O)c1ccc(N2CCNC(=O)C2(C)C)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H19N3O4/c1-9(18)10-4-5-11(12(8-10)17(20)21)16-7-6-15-13(19)14(16,2)3/h4-5,8-9,18H,6-7H2,1-3H3,(H,15,19)/t9-/m0/s1 |
| InChIKey | GGGIWDXBHVSEEF-VIFPVBQESA-N |
| XLogP | 1.36 |
| TPSA | 95.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|