C18H25NS — CID 78963724
N-(2-methyl-2-thiophen-2-ylpropyl)-4-phenylbutan-2-amine (PubChem CID 78963724) has the molecular formula C18H25NS and a molecular weight of 287.47 g/mol. Its IUPAC name is N-(2-methyl-2-thiophen-2-ylpropyl)-4-phenylbutan-2-amine.
| Compound Name | N-(2-methyl-2-thiophen-2-ylpropyl)-4-phenylbutan-2-amine |
|---|---|
| PubChem CID | 78963724 |
| Molecular Formula | C18H25NS |
| Molecular Weight | 287.47 g/mol |
| Exact Mass | 287.17 |
| IUPAC Name | N-(2-methyl-2-thiophen-2-ylpropyl)-4-phenylbutan-2-amine |
| SMILES | CC(CCc1ccccc1)NCC(C)(C)c1cccs1 |
| InChI | InChI=1S/C18H25NS/c1-15(11-12-16-8-5-4-6-9-16)19-14-18(2,3)17-10-7-13-20-17/h4-10,13,15,19H,11-12,14H2,1-3H3 |
| InChIKey | FBXSLVYMULOXFZ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.47 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |