C12H11N3O2 — CID 78965676
3-amino-4-(3-methyl-2,5-dioxopyrrolidin-1-yl)benzonitrile (PubChem CID 78965676) has the molecular formula C12H11N3O2 and a molecular weight of 229.24 g/mol. Its IUPAC name is 3-amino-4-(3-methyl-2,5-dioxopyrrolidin-1-yl)benzonitrile.
| Compound Name | 3-amino-4-(3-methyl-2,5-dioxopyrrolidin-1-yl)benzonitrile |
|---|---|
| PubChem CID | 78965676 |
| Molecular Formula | C12H11N3O2 |
| Molecular Weight | 229.24 g/mol |
| Exact Mass | 229.09 |
| IUPAC Name | 3-amino-4-(3-methyl-2,5-dioxopyrrolidin-1-yl)benzonitrile |
| SMILES | CC1CC(=O)N(c2ccc(C#N)cc2N)C1=O |
| InChI | InChI=1S/C12H11N3O2/c1-7-4-11(16)15(12(7)17)10-3-2-8(6-13)5-9(10)14/h2-3,5,7H,4,14H2,1H3 |
| InChIKey | OUBVZWFVIPDFEF-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 87.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.24 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|