4-(2,7-dioxoazepan-1-yl)oxane-4-carboxylic acid

C12H17NO5 — CID 78969588

IUPAC4-(2,7-dioxoazepan-1-yl)oxane-4-carboxylic acid
SMILESO=C1CCCCC(=O)N1C1(C(=O)O)CCOCC1
InChIInChI=1S/C12H17NO5/c14-9-3-1-2-4-10(15)13(9)12(11(16)17)5-7-18-8-6-12/h1-8H2,(H,16,17)
InChIKeyKYHWJRSMICZGHR-UHFFFAOYSA-N
MW255.27 g/mol
LogP0.55
Rot. Bonds2

About 4-(2,7-dioxoazepan-1-yl)oxane-4-carboxylic acid

4-(2,7-dioxoazepan-1-yl)oxane-4-carboxylic acid (PubChem CID 78969588) has the molecular formula C12H17NO5 and a molecular weight of 255.27 g/mol. Its IUPAC name is 4-(2,7-dioxoazepan-1-yl)oxane-4-carboxylic acid.

Molecular Properties

Compound Name4-(2,7-dioxoazepan-1-yl)oxane-4-carboxylic acid
PubChem CID78969588
Molecular FormulaC12H17NO5
Molecular Weight255.27 g/mol
Exact Mass255.11
IUPAC Name4-(2,7-dioxoazepan-1-yl)oxane-4-carboxylic acid
SMILESO=C1CCCCC(=O)N1C1(C(=O)O)CCOCC1
InChIInChI=1S/C12H17NO5/c14-9-3-1-2-4-10(15)13(9)12(11(16)17)5-7-18-8-6-12/h1-8H2,(H,16,17)
InChIKeyKYHWJRSMICZGHR-UHFFFAOYSA-N
XLogP0.55
TPSA83.91 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500255.27
LogP ≤ 50.55
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phthalimide', 'substructure': 'N/A'}

Analyze 4-(2,7-dioxoazepan-1-yl)oxane-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(2,7-dioxoazepan-1-yl)oxane-4-carboxylic acid?
The IUPAC name of 4-(2,7-dioxoazepan-1-yl)oxane-4-carboxylic acid (CID 78969588) is 4-(2,7-dioxoazepan-1-yl)oxane-4-carboxylic acid.
What is the SMILES notation for 4-(2,7-dioxoazepan-1-yl)oxane-4-carboxylic acid?
The canonical SMILES for 4-(2,7-dioxoazepan-1-yl)oxane-4-carboxylic acid is O=C1CCCCC(=O)N1C1(C(=O)O)CCOCC1.
What is the InChIKey of 4-(2,7-dioxoazepan-1-yl)oxane-4-carboxylic acid?
The InChIKey is KYHWJRSMICZGHR-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO5/c14-9-3-1-2-4-10(15)13(9)12(11(16)17)5-7-18-8-6-12/h1-8H2,(H,16,17).
What are the key properties of 4-(2,7-dioxoazepan-1-yl)oxane-4-carboxylic acid?
4-(2,7-dioxoazepan-1-yl)oxane-4-carboxylic acid has a molecular weight of 255.27 g/mol, XLogP of 0.55, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2,7-dioxoazepan-1-yl)oxane-4-carboxylic acid is sourced from PubChem (CID 78969588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).