C10H13NO4S — CID 82235170
3-(2,6-dioxopiperidin-1-yl)thiolane-3-carboxylic acid (PubChem CID 82235170) has the molecular formula C10H13NO4S and a molecular weight of 243.28 g/mol. Its IUPAC name is 3-(2,6-dioxopiperidin-1-yl)thiolane-3-carboxylic acid.
| Compound Name | 3-(2,6-dioxopiperidin-1-yl)thiolane-3-carboxylic acid |
|---|---|
| PubChem CID | 82235170 |
| Molecular Formula | C10H13NO4S |
| Molecular Weight | 243.28 g/mol |
| Exact Mass | 243.06 |
| IUPAC Name | 3-(2,6-dioxopiperidin-1-yl)thiolane-3-carboxylic acid |
| SMILES | O=C1CCCC(=O)N1C1(C(=O)O)CCSC1 |
| InChI | InChI=1S/C10H13NO4S/c12-7-2-1-3-8(13)11(7)10(9(14)15)4-5-16-6-10/h1-6H2,(H,14,15) |
| InChIKey | STIVQMMSOSEMIM-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.28 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|