3-(4,5-dimethylimidazol-1-yl)thiane-3-carboxylic acid

C11H16N2O2S — CID 82235944

IUPAC3-(4,5-dimethylimidazol-1-yl)thiane-3-carboxylic acid
SMILESCc1ncn(C2(C(=O)O)CCCSC2)c1C
InChIInChI=1S/C11H16N2O2S/c1-8-9(2)13(7-12-8)11(10(14)15)4-3-5-16-6-11/h7H,3-6H2,1-2H3,(H,14,15)
InChIKeyKBEYCDPUCQGIKE-UHFFFAOYSA-N
MW240.33 g/mol
LogP1.81
Rot. Bonds2

About 3-(4,5-dimethylimidazol-1-yl)thiane-3-carboxylic acid

3-(4,5-dimethylimidazol-1-yl)thiane-3-carboxylic acid (PubChem CID 82235944) has the molecular formula C11H16N2O2S and a molecular weight of 240.33 g/mol. Its IUPAC name is 3-(4,5-dimethylimidazol-1-yl)thiane-3-carboxylic acid.

Molecular Properties

Compound Name3-(4,5-dimethylimidazol-1-yl)thiane-3-carboxylic acid
PubChem CID82235944
Molecular FormulaC11H16N2O2S
Molecular Weight240.33 g/mol
Exact Mass240.09
IUPAC Name3-(4,5-dimethylimidazol-1-yl)thiane-3-carboxylic acid
SMILESCc1ncn(C2(C(=O)O)CCCSC2)c1C
InChIInChI=1S/C11H16N2O2S/c1-8-9(2)13(7-12-8)11(10(14)15)4-3-5-16-6-11/h7H,3-6H2,1-2H3,(H,14,15)
InChIKeyKBEYCDPUCQGIKE-UHFFFAOYSA-N
XLogP1.81
TPSA55.12 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500240.33
LogP ≤ 51.81
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 3-(4,5-dimethylimidazol-1-yl)thiane-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(4,5-dimethylimidazol-1-yl)thiane-3-carboxylic acid?
The IUPAC name of 3-(4,5-dimethylimidazol-1-yl)thiane-3-carboxylic acid (CID 82235944) is 3-(4,5-dimethylimidazol-1-yl)thiane-3-carboxylic acid.
What is the SMILES notation for 3-(4,5-dimethylimidazol-1-yl)thiane-3-carboxylic acid?
The canonical SMILES for 3-(4,5-dimethylimidazol-1-yl)thiane-3-carboxylic acid is Cc1ncn(C2(C(=O)O)CCCSC2)c1C.
What is the InChIKey of 3-(4,5-dimethylimidazol-1-yl)thiane-3-carboxylic acid?
The InChIKey is KBEYCDPUCQGIKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16N2O2S/c1-8-9(2)13(7-12-8)11(10(14)15)4-3-5-16-6-11/h7H,3-6H2,1-2H3,(H,14,15).
What are the key properties of 3-(4,5-dimethylimidazol-1-yl)thiane-3-carboxylic acid?
3-(4,5-dimethylimidazol-1-yl)thiane-3-carboxylic acid has a molecular weight of 240.33 g/mol, XLogP of 1.81, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4,5-dimethylimidazol-1-yl)thiane-3-carboxylic acid is sourced from PubChem (CID 82235944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).