4-(3,5-dimethyl-1,2,4-triazol-1-yl)thiane-4-carboxylic acid

C10H15N3O2S — CID 82235209

IUPAC4-(3,5-dimethyl-1,2,4-triazol-1-yl)thiane-4-carboxylic acid
SMILESCc1nc(C)n(C2(C(=O)O)CCSCC2)n1
InChIInChI=1S/C10H15N3O2S/c1-7-11-8(2)13(12-7)10(9(14)15)3-5-16-6-4-10/h3-6H2,1-2H3,(H,14,15)
InChIKeyIENTWIFIZMUMLL-UHFFFAOYSA-N
MW241.32 g/mol
LogP1.20
Rot. Bonds2

About 4-(3,5-dimethyl-1,2,4-triazol-1-yl)thiane-4-carboxylic acid

4-(3,5-dimethyl-1,2,4-triazol-1-yl)thiane-4-carboxylic acid (PubChem CID 82235209) has the molecular formula C10H15N3O2S and a molecular weight of 241.32 g/mol. Its IUPAC name is 4-(3,5-dimethyl-1,2,4-triazol-1-yl)thiane-4-carboxylic acid.

Molecular Properties

Compound Name4-(3,5-dimethyl-1,2,4-triazol-1-yl)thiane-4-carboxylic acid
PubChem CID82235209
Molecular FormulaC10H15N3O2S
Molecular Weight241.32 g/mol
Exact Mass241.09
IUPAC Name4-(3,5-dimethyl-1,2,4-triazol-1-yl)thiane-4-carboxylic acid
SMILESCc1nc(C)n(C2(C(=O)O)CCSCC2)n1
InChIInChI=1S/C10H15N3O2S/c1-7-11-8(2)13(12-7)10(9(14)15)3-5-16-6-4-10/h3-6H2,1-2H3,(H,14,15)
InChIKeyIENTWIFIZMUMLL-UHFFFAOYSA-N
XLogP1.20
TPSA68.01 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500241.32
LogP ≤ 51.20
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 4-(3,5-dimethyl-1,2,4-triazol-1-yl)thiane-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(3,5-dimethyl-1,2,4-triazol-1-yl)thiane-4-carboxylic acid?
The IUPAC name of 4-(3,5-dimethyl-1,2,4-triazol-1-yl)thiane-4-carboxylic acid (CID 82235209) is 4-(3,5-dimethyl-1,2,4-triazol-1-yl)thiane-4-carboxylic acid.
What is the SMILES notation for 4-(3,5-dimethyl-1,2,4-triazol-1-yl)thiane-4-carboxylic acid?
The canonical SMILES for 4-(3,5-dimethyl-1,2,4-triazol-1-yl)thiane-4-carboxylic acid is Cc1nc(C)n(C2(C(=O)O)CCSCC2)n1.
What is the InChIKey of 4-(3,5-dimethyl-1,2,4-triazol-1-yl)thiane-4-carboxylic acid?
The InChIKey is IENTWIFIZMUMLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15N3O2S/c1-7-11-8(2)13(12-7)10(9(14)15)3-5-16-6-4-10/h3-6H2,1-2H3,(H,14,15).
What are the key properties of 4-(3,5-dimethyl-1,2,4-triazol-1-yl)thiane-4-carboxylic acid?
4-(3,5-dimethyl-1,2,4-triazol-1-yl)thiane-4-carboxylic acid has a molecular weight of 241.32 g/mol, XLogP of 1.20, 2 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,5-dimethyl-1,2,4-triazol-1-yl)thiane-4-carboxylic acid is sourced from PubChem (CID 82235209), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).