C9H16N2O — CID 78970040
1-ethyl-3-propyl-1-prop-2-ynylurea (PubChem CID 78970040) has the molecular formula C9H16N2O and a molecular weight of 168.24 g/mol. Its IUPAC name is 1-ethyl-3-propyl-1-prop-2-ynylurea.
| Compound Name | 1-ethyl-3-propyl-1-prop-2-ynylurea |
|---|---|
| PubChem CID | 78970040 |
| Molecular Formula | C9H16N2O |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.13 |
| IUPAC Name | 1-ethyl-3-propyl-1-prop-2-ynylurea |
| SMILES | C#CCN(CC)C(=O)NCCC |
| InChI | InChI=1S/C9H16N2O/c1-4-7-10-9(12)11(6-3)8-5-2/h2H,4,6-8H2,1,3H3,(H,10,12) |
| InChIKey | JBOMCBDDPZHEFL-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|