C11H15N5O3 — CID 78974609
6-[(3,5-dimethyl-1,2-oxazol-4-yl)methylamino]-2,4-dimethyl-1,2,4-triazine-3,5-dione (PubChem CID 78974609) has the molecular formula C11H15N5O3 and a molecular weight of 265.27 g/mol. Its IUPAC name is 6-[(3,5-dimethyl-1,2-oxazol-4-yl)methylamino]-2,4-dimethyl-1,2,4-triazine-3,5-dione.
| Compound Name | 6-[(3,5-dimethyl-1,2-oxazol-4-yl)methylamino]-2,4-dimethyl-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 78974609 |
| Molecular Formula | C11H15N5O3 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.12 |
| IUPAC Name | 6-[(3,5-dimethyl-1,2-oxazol-4-yl)methylamino]-2,4-dimethyl-1,2,4-triazine-3,5-dione |
| SMILES | Cc1noc(C)c1CNc1nn(C)c(=O)n(C)c1=O |
| InChI | InChI=1S/C11H15N5O3/c1-6-8(7(2)19-14-6)5-12-9-10(17)15(3)11(18)16(4)13-9/h5H2,1-4H3,(H,12,13) |
| InChIKey | KENQYYVBYYFATC-UHFFFAOYSA-N |
| XLogP | -0.30 |
| TPSA | 94.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |