C14H16ClNO3S — CID 78980263
4-[3-(2-chlorophenyl)propanoyl]thiomorpholine-3-carboxylic acid (PubChem CID 78980263) has the molecular formula C14H16ClNO3S and a molecular weight of 313.81 g/mol. Its IUPAC name is 4-[3-(2-chlorophenyl)propanoyl]thiomorpholine-3-carboxylic acid.
| Compound Name | 4-[3-(2-chlorophenyl)propanoyl]thiomorpholine-3-carboxylic acid |
|---|---|
| PubChem CID | 78980263 |
| Molecular Formula | C14H16ClNO3S |
| Molecular Weight | 313.81 g/mol |
| Exact Mass | 313.05 |
| IUPAC Name | 4-[3-(2-chlorophenyl)propanoyl]thiomorpholine-3-carboxylic acid |
| SMILES | O=C(O)C1CSCCN1C(=O)CCc1ccccc1Cl |
| InChI | InChI=1S/C14H16ClNO3S/c15-11-4-2-1-3-10(11)5-6-13(17)16-7-8-20-9-12(16)14(18)19/h1-4,12H,5-9H2,(H,18,19) |
| InChIKey | DQAYHWDHDVAZIO-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.81 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |